C17H16N4O3S2 — CID 90349339
N-(4-methyl-5-sulfamoyl-1,3-thiazol-2-yl)-2-(4-pyridin-2-ylphenyl)acetamide (PubChem CID 90349339) has the molecular formula C17H16N4O3S2 and a molecular weight of 388.47 g/mol. Its IUPAC name is N-(4-methyl-5-sulfamoyl-1,3-thiazol-2-yl)-2-(4-pyridin-2-ylphenyl)acetamide.
| Compound Name | N-(4-methyl-5-sulfamoyl-1,3-thiazol-2-yl)-2-(4-pyridin-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 90349339 |
| Molecular Formula | C17H16N4O3S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | N-(4-methyl-5-sulfamoyl-1,3-thiazol-2-yl)-2-(4-pyridin-2-ylphenyl)acetamide |
| SMILES | Cc1nc(NC(=O)Cc2ccc(-c3ccccn3)cc2)sc1S(N)(=O)=O |
| InChI | InChI=1S/C17H16N4O3S2/c1-11-16(26(18,23)24)25-17(20-11)21-15(22)10-12-5-7-13(8-6-12)14-4-2-3-9-19-14/h2-9H,10H2,1H3,(H2,18,23,24)(H,20,21,22) |
| InChIKey | AEMFAJZFNUUFAZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |