About CID 90349760
CID 90349760 (PubChem CID 90349760) has the molecular formula C12H22BFO3Si
and a molecular weight of 272.20 g/mol.
Molecular Properties
| Compound Name | CID 90349760 |
| PubChem CID | 90349760 |
| Molecular Formula | C12H22BFO3Si |
| Molecular Weight | 272.20 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@H](C=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@]1(C)F |
| InChI | InChI=1S/C12H22BFO3Si/c1-11(2,3)18(5,6)17-9-8(7-15)16-10(13)12(9,4)14/h7-10H,1-6H3/t8-,9-,10-,12-/m1/s1 |
| InChIKey | YBYNDLHESHMCAB-DNRKLUKYSA-N |
| XLogP | 2.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.20 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 90349760 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90349760?
The IUPAC name of CID 90349760 (CID 90349760) is not available.
What is the SMILES notation for CID 90349760?
The canonical SMILES for CID 90349760 is [B][C@@H]1O[C@H](C=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@]1(C)F.
What is the InChIKey of CID 90349760?
The InChIKey is YBYNDLHESHMCAB-DNRKLUKYSA-N. The full InChI is InChI=1S/C12H22BFO3Si/c1-11(2,3)18(5,6)17-9-8(7-15)16-10(13)12(9,4)14/h7-10H,1-6H3/t8-,9-,10-,12-/m1/s1.
What are the key properties of CID 90349760?
CID 90349760 has a molecular weight of 272.20 g/mol, XLogP of 2.20, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90349760 is sourced from PubChem (CID 90349760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).