C42H39N3O4S2 — CID 90349801
(E)-2-cyano-3-[5-[1-hexyl-5-[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]pyrrol-2-yl]thieno[3,2-b]thiophen-2-yl]prop-2-enoic acid (PubChem CID 90349801) has the molecular formula C42H39N3O4S2 and a molecular weight of 713.93 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[1-hexyl-5-[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]pyrrol-2-yl]thieno[3,2-b]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[5-[1-hexyl-5-[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]pyrrol-2-yl]thieno[3,2-b]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 90349801 |
| Molecular Formula | C42H39N3O4S2 |
| Molecular Weight | 713.93 g/mol |
| Exact Mass | 713.24 |
| IUPAC Name | (E)-2-cyano-3-[5-[1-hexyl-5-[(E)-2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]ethenyl]pyrrol-2-yl]thieno[3,2-b]thiophen-2-yl]prop-2-enoic acid |
| SMILES | CCCCCCn1c(/C=C/c2ccc(N(c3ccc(OC)cc3)c3ccc(OC)cc3)cc2)ccc1-c1cc2sc(/C=C(\C#N)C(=O)O)cc2s1 |
| InChI | InChI=1S/C42H39N3O4S2/c1-4-5-6-7-24-44-31(18-23-38(44)39-27-41-40(51-39)26-37(50-41)25-30(28-43)42(46)47)11-8-29-9-12-32(13-10-29)45(33-14-19-35(48-2)20-15-33)34-16-21-36(49-3)22-17-34/h8-23,25-27H,4-7,24H2,1-3H3,(H,46,47)/b11-8+,30-25+ |
| InChIKey | YIHYXCJEYBWYQJ-KUHISYQZSA-N |
| XLogP | 11.66 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.93 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|