C20H22N4O — CID 90349842
N-[1-(3-cyano-2-pyridinyl)piperidin-4-yl]-N-phenylpropanamide (PubChem CID 90349842) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[1-(3-cyano-2-pyridinyl)piperidin-4-yl]-N-phenylpropanamide.
| Compound Name | N-[1-(3-cyano-2-pyridinyl)piperidin-4-yl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 90349842 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | N-[1-(3-cyano-2-pyridinyl)piperidin-4-yl]-N-phenylpropanamide |
| SMILES | CCC(=O)N(c1ccccc1)C1CCN(c2ncccc2C#N)CC1 |
| InChI | InChI=1S/C20H22N4O/c1-2-19(25)24(17-8-4-3-5-9-17)18-10-13-23(14-11-18)20-16(15-21)7-6-12-22-20/h3-9,12,18H,2,10-11,13-14H2,1H3 |
| InChIKey | SRTTXFVDNUNCOF-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |