C19H28O2 — CID 90350213
(1R,2S,5S,7R,8S,11S,12R,16R)-2,16-dimethyl-6-oxapentacyclo[9.7.0.02,8.05,7.012,16]octadecan-15-one (PubChem CID 90350213) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (1R,2S,5S,7R,8S,11S,12R,16R)-2,16-dimethyl-6-oxapentacyclo[9.7.0.02,8.05,7.012,16]octadecan-15-one.
| Compound Name | (1R,2S,5S,7R,8S,11S,12R,16R)-2,16-dimethyl-6-oxapentacyclo[9.7.0.02,8.05,7.012,16]octadecan-15-one |
|---|---|
| PubChem CID | 90350213 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (1R,2S,5S,7R,8S,11S,12R,16R)-2,16-dimethyl-6-oxapentacyclo[9.7.0.02,8.05,7.012,16]octadecan-15-one |
| SMILES | C[C@@]12CC[C@@H]3O[C@@H]3[C@H]1CC[C@H]1[C@H]2CC[C@@]2(C)C(=O)CC[C@H]12 |
| InChI | InChI=1S/C19H28O2/c1-18-10-8-15-17(21-15)14(18)4-3-11-12-5-6-16(20)19(12,2)9-7-13(11)18/h11-15,17H,3-10H2,1-2H3/t11-,12-,13-,14-,15+,17-,18+,19-/m1/s1 |
| InChIKey | ALHYGULCJHAJFX-GPMVPIICSA-N |
| XLogP | 3.98 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|