C25H40O6S — CID 90350375
[(1R,2R,3R,4S)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-4-hydroxy-3-methylcyclopentyl] 4-methylbenzenesulfonate (PubChem CID 90350375) has the molecular formula C25H40O6S and a molecular weight of 468.66 g/mol. Its IUPAC name is [(1R,2R,3R,4S)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-4-hydroxy-3-methylcyclopentyl] 4-methylbenzenesulfonate.
| Compound Name | [(1R,2R,3R,4S)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-4-hydroxy-3-methylcyclopentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 90350375 |
| Molecular Formula | C25H40O6S |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | [(1R,2R,3R,4S)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-4-hydroxy-3-methylcyclopentyl] 4-methylbenzenesulfonate |
| SMILES | CCCCCCCC1(CC[C@@H]2[C@@H](C)[C@@H](O)C[C@H]2OS(=O)(=O)c2ccc(C)cc2)OCCO1 |
| InChI | InChI=1S/C25H40O6S/c1-4-5-6-7-8-14-25(29-16-17-30-25)15-13-22-20(3)23(26)18-24(22)31-32(27,28)21-11-9-19(2)10-12-21/h9-12,20,22-24,26H,4-8,13-18H2,1-3H3/t20-,22-,23+,24-/m1/s1 |
| InChIKey | XUGGJOMKIYWYJY-CAUSLRQDSA-N |
| XLogP | 4.97 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|