About (4S,5R)-4-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-methylcyclopent-2-en-1-one
(4S,5R)-4-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-methylcyclopent-2-en-1-one (PubChem CID 90350376) has the molecular formula C18H30O3
and a molecular weight of 294.44 g/mol. Its IUPAC name is (4S,5R)-4-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-methylcyclopent-2-en-1-one.
Molecular Properties
| Compound Name | (4S,5R)-4-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-methylcyclopent-2-en-1-one |
| PubChem CID | 90350376 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (4S,5R)-4-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-methylcyclopent-2-en-1-one |
| SMILES | CCCCCCCC1(CC[C@H]2C=CC(=O)[C@@H]2C)OCCO1 |
| InChI | InChI=1S/C18H30O3/c1-3-4-5-6-7-11-18(20-13-14-21-18)12-10-16-8-9-17(19)15(16)2/h8-9,15-16H,3-7,10-14H2,1-2H3/t15-,16-/m1/s1 |
| InChIKey | CQHDKPUVJUOFEH-HZPDHXFCSA-N |
| XLogP | 4.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4S,5R)-4-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-methylcyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5R)-4-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-methylcyclopent-2-en-1-one?
The IUPAC name of (4S,5R)-4-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-methylcyclopent-2-en-1-one (CID 90350376) is (4S,5R)-4-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-methylcyclopent-2-en-1-one.
What is the SMILES notation for (4S,5R)-4-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-methylcyclopent-2-en-1-one?
The canonical SMILES for (4S,5R)-4-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-methylcyclopent-2-en-1-one is CCCCCCCC1(CC[C@H]2C=CC(=O)[C@@H]2C)OCCO1.
What is the InChIKey of (4S,5R)-4-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-methylcyclopent-2-en-1-one?
The InChIKey is CQHDKPUVJUOFEH-HZPDHXFCSA-N. The full InChI is InChI=1S/C18H30O3/c1-3-4-5-6-7-11-18(20-13-14-21-18)12-10-16-8-9-17(19)15(16)2/h8-9,15-16H,3-7,10-14H2,1-2H3/t15-,16-/m1/s1.
What are the key properties of (4S,5R)-4-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-methylcyclopent-2-en-1-one?
(4S,5R)-4-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-methylcyclopent-2-en-1-one has a molecular weight of 294.44 g/mol, XLogP of 4.26, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5R)-4-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-5-methylcyclopent-2-en-1-one is sourced from PubChem (CID 90350376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).