C26H28N2O5 — CID 90350468
5-[2-[(3S,9aS)-3-(1-oxo-3H-2-benzofuran-5-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]ethyl]-4-methyl-3H-2-benzofuran-1-one (PubChem CID 90350468) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is 5-[2-[(3S,9aS)-3-(1-oxo-3H-2-benzofuran-5-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]ethyl]-4-methyl-3H-2-benzofuran-1-one.
| Compound Name | 5-[2-[(3S,9aS)-3-(1-oxo-3H-2-benzofuran-5-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]ethyl]-4-methyl-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 90350468 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 5-[2-[(3S,9aS)-3-(1-oxo-3H-2-benzofuran-5-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]ethyl]-4-methyl-3H-2-benzofuran-1-one |
| SMILES | Cc1c(CCN2CCN3C[C@H](c4ccc5c(c4)COC5=O)OC[C@@H]3C2)ccc2c1COC2=O |
| InChI | InChI=1S/C26H28N2O5/c1-16-17(2-5-22-23(16)15-33-26(22)30)6-7-27-8-9-28-12-24(31-14-20(28)11-27)18-3-4-21-19(10-18)13-32-25(21)29/h2-5,10,20,24H,6-9,11-15H2,1H3/t20-,24+/m0/s1 |
| InChIKey | IPEZTVQQTAGKTI-GBXCKJPGSA-N |
| XLogP | 2.64 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |