C25H25F2N3O3 — CID 90350533
4-[2-[(3R,9aS)-3-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]ethyl]-2,6-difluorobenzonitrile (PubChem CID 90350533) has the molecular formula C25H25F2N3O3 and a molecular weight of 453.49 g/mol. Its IUPAC name is 4-[2-[(3R,9aS)-3-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]ethyl]-2,6-difluorobenzonitrile.
| Compound Name | 4-[2-[(3R,9aS)-3-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]ethyl]-2,6-difluorobenzonitrile |
|---|---|
| PubChem CID | 90350533 |
| Molecular Formula | C25H25F2N3O3 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 4-[2-[(3R,9aS)-3-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]ethyl]-2,6-difluorobenzonitrile |
| SMILES | Cc1c([C@@H]2CN3CCN(CCc4cc(F)c(C#N)c(F)c4)C[C@H]3CO2)ccc2c1COC2=O |
| InChI | InChI=1S/C25H25F2N3O3/c1-15-18(2-3-19-21(15)14-33-25(19)31)24-12-30-7-6-29(11-17(30)13-32-24)5-4-16-8-22(26)20(10-28)23(27)9-16/h2-3,8-9,17,24H,4-7,11-14H2,1H3/t17-,24-/m0/s1 |
| InChIKey | NIUOUEGEFFEMBO-XDHUDOTRSA-N |
| XLogP | 3.12 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |