C31H30O2 — CID 90350735
4-[9-(4-hydroxy-3-prop-2-enylcyclohexa-2,4-dien-1-yl)-3,4-dihydrofluoren-9-yl]-2-prop-2-enylphenol (PubChem CID 90350735) has the molecular formula C31H30O2 and a molecular weight of 434.58 g/mol. Its IUPAC name is 4-[9-(4-hydroxy-3-prop-2-enylcyclohexa-2,4-dien-1-yl)-3,4-dihydrofluoren-9-yl]-2-prop-2-enylphenol.
| Compound Name | 4-[9-(4-hydroxy-3-prop-2-enylcyclohexa-2,4-dien-1-yl)-3,4-dihydrofluoren-9-yl]-2-prop-2-enylphenol |
|---|---|
| PubChem CID | 90350735 |
| Molecular Formula | C31H30O2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 4-[9-(4-hydroxy-3-prop-2-enylcyclohexa-2,4-dien-1-yl)-3,4-dihydrofluoren-9-yl]-2-prop-2-enylphenol |
| SMILES | C=CCC1=CC(C2(c3ccc(O)c(CC=C)c3)C3=C(CCC=C3)c3ccccc32)CC=C1O |
| InChI | InChI=1S/C31H30O2/c1-3-9-21-19-23(15-17-29(21)32)31(24-16-18-30(33)22(20-24)10-4-2)27-13-7-5-11-25(27)26-12-6-8-14-28(26)31/h3-5,7-8,11,13-15,17-20,24,32-33H,1-2,6,9-10,12,16H2 |
| InChIKey | HBSRYBOPSNRVAW-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|