C15H29NO2 — CID 90350763
(3S,5R,7E)-3-ethyl-4,5-dimethyl-7-[(2-methylpropan-2-yl)oxyimino]heptan-2-one (PubChem CID 90350763) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is (3S,5R,7E)-3-ethyl-4,5-dimethyl-7-[(2-methylpropan-2-yl)oxyimino]heptan-2-one.
| Compound Name | (3S,5R,7E)-3-ethyl-4,5-dimethyl-7-[(2-methylpropan-2-yl)oxyimino]heptan-2-one |
|---|---|
| PubChem CID | 90350763 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | (3S,5R,7E)-3-ethyl-4,5-dimethyl-7-[(2-methylpropan-2-yl)oxyimino]heptan-2-one |
| SMILES | CCC(C(C)=O)C(C)[C@H](C)C/C=N/OC(C)(C)C |
| InChI | InChI=1S/C15H29NO2/c1-8-14(13(4)17)12(3)11(2)9-10-16-18-15(5,6)7/h10-12,14H,8-9H2,1-7H3/b16-10+/t11-,12?,14?/m1/s1 |
| InChIKey | OXFLKEXXLKDCDP-YEEYHZFYSA-N |
| XLogP | 4.06 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|