C12H17N5O3 — CID 90351309
tert-butyl N-[(7S)-6-oxo-5,7,8,9-tetrahydropyrimido[4,5-b][1,4]diazepin-7-yl]carbamate (PubChem CID 90351309) has the molecular formula C12H17N5O3 and a molecular weight of 279.30 g/mol. Its IUPAC name is tert-butyl N-[(7S)-6-oxo-5,7,8,9-tetrahydropyrimido[4,5-b][1,4]diazepin-7-yl]carbamate.
| Compound Name | tert-butyl N-[(7S)-6-oxo-5,7,8,9-tetrahydropyrimido[4,5-b][1,4]diazepin-7-yl]carbamate |
|---|---|
| PubChem CID | 90351309 |
| Molecular Formula | C12H17N5O3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | tert-butyl N-[(7S)-6-oxo-5,7,8,9-tetrahydropyrimido[4,5-b][1,4]diazepin-7-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CNc2ncncc2NC1=O |
| InChI | InChI=1S/C12H17N5O3/c1-12(2,3)20-11(19)17-8-5-14-9-7(16-10(8)18)4-13-6-15-9/h4,6,8H,5H2,1-3H3,(H,16,18)(H,17,19)(H,13,14,15)/t8-/m0/s1 |
| InChIKey | ONMPFSDQXXUSEY-QMMMGPOBSA-N |
| XLogP | 0.73 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |