About (4S)-2,4-dimethyl-4-[methyl(propan-2-yl)amino]non-8-en-3-one
(4S)-2,4-dimethyl-4-[methyl(propan-2-yl)amino]non-8-en-3-one (PubChem CID 90351464) has the molecular formula C15H29NO
and a molecular weight of 239.40 g/mol. Its IUPAC name is (4S)-2,4-dimethyl-4-[methyl(propan-2-yl)amino]non-8-en-3-one.
Molecular Properties
| Compound Name | (4S)-2,4-dimethyl-4-[methyl(propan-2-yl)amino]non-8-en-3-one |
| PubChem CID | 90351464 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | (4S)-2,4-dimethyl-4-[methyl(propan-2-yl)amino]non-8-en-3-one |
| SMILES | C=CCCC[C@@](C)(C(=O)C(C)C)N(C)C(C)C |
| InChI | InChI=1S/C15H29NO/c1-8-9-10-11-15(6,14(17)12(2)3)16(7)13(4)5/h8,12-13H,1,9-11H2,2-7H3/t15-/m0/s1 |
| InChIKey | ZYWIIVHSARXTIY-HNNXBMFYSA-N |
| XLogP | 3.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4S)-2,4-dimethyl-4-[methyl(propan-2-yl)amino]non-8-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2,4-dimethyl-4-[methyl(propan-2-yl)amino]non-8-en-3-one?
The IUPAC name of (4S)-2,4-dimethyl-4-[methyl(propan-2-yl)amino]non-8-en-3-one (CID 90351464) is (4S)-2,4-dimethyl-4-[methyl(propan-2-yl)amino]non-8-en-3-one.
What is the SMILES notation for (4S)-2,4-dimethyl-4-[methyl(propan-2-yl)amino]non-8-en-3-one?
The canonical SMILES for (4S)-2,4-dimethyl-4-[methyl(propan-2-yl)amino]non-8-en-3-one is C=CCCC[C@@](C)(C(=O)C(C)C)N(C)C(C)C.
What is the InChIKey of (4S)-2,4-dimethyl-4-[methyl(propan-2-yl)amino]non-8-en-3-one?
The InChIKey is ZYWIIVHSARXTIY-HNNXBMFYSA-N. The full InChI is InChI=1S/C15H29NO/c1-8-9-10-11-15(6,14(17)12(2)3)16(7)13(4)5/h8,12-13H,1,9-11H2,2-7H3/t15-/m0/s1.
What are the key properties of (4S)-2,4-dimethyl-4-[methyl(propan-2-yl)amino]non-8-en-3-one?
(4S)-2,4-dimethyl-4-[methyl(propan-2-yl)amino]non-8-en-3-one has a molecular weight of 239.40 g/mol, XLogP of 3.67, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2,4-dimethyl-4-[methyl(propan-2-yl)amino]non-8-en-3-one is sourced from PubChem (CID 90351464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).