About 8-methyl-4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-7-carbonitrile
8-methyl-4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-7-carbonitrile (PubChem CID 90351505) has the molecular formula C11H10N2O2
and a molecular weight of 202.21 g/mol. Its IUPAC name is 8-methyl-4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-7-carbonitrile.
Molecular Properties
| Compound Name | 8-methyl-4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-7-carbonitrile |
| PubChem CID | 90351505 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 8-methyl-4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-7-carbonitrile |
| SMILES | Cc1cc2c(cc1C#N)NC(=O)CCO2 |
| InChI | InChI=1S/C11H10N2O2/c1-7-4-10-9(5-8(7)6-12)13-11(14)2-3-15-10/h4-5H,2-3H2,1H3,(H,13,14) |
| InChIKey | RNGUAMGOFIAWEK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-methyl-4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-7-carbonitrile?
The IUPAC name of 8-methyl-4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-7-carbonitrile (CID 90351505) is 8-methyl-4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-7-carbonitrile.
What is the SMILES notation for 8-methyl-4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-7-carbonitrile?
The canonical SMILES for 8-methyl-4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-7-carbonitrile is Cc1cc2c(cc1C#N)NC(=O)CCO2.
What is the InChIKey of 8-methyl-4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-7-carbonitrile?
The InChIKey is RNGUAMGOFIAWEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O2/c1-7-4-10-9(5-8(7)6-12)13-11(14)2-3-15-10/h4-5H,2-3H2,1H3,(H,13,14).
What are the key properties of 8-methyl-4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-7-carbonitrile?
8-methyl-4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-7-carbonitrile has a molecular weight of 202.21 g/mol, XLogP of 1.59, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-7-carbonitrile is sourced from PubChem (CID 90351505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).