C17H30N2Si+ — CID 90351841
CID 90351841 (PubChem CID 90351841) has the molecular formula C17H30N2Si+ and a molecular weight of 290.53 g/mol.
| Compound Name | CID 90351841 |
|---|---|
| PubChem CID | 90351841 |
| Molecular Formula | C17H30N2Si+ |
| Molecular Weight | 290.53 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | — |
| SMILES | C[N+](C)(CCCCCNCCC[Si])Cc1ccccc1 |
| InChI | InChI=1S/C17H30N2Si/c1-19(2,16-17-10-5-3-6-11-17)14-8-4-7-12-18-13-9-15-20/h3,5-6,10-11,18H,4,7-9,12-16H2,1-2H3/q+1 |
| InChIKey | HBCYXRQJQIDNLG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.53 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|