C26H36O17 — CID 90352093
[(1R,4S,5R,6R,8R,11R,12R,15S,16S)-4,5,12,15,16-pentaacetyloxy-6-methoxy-2,7,10,14-tetraoxatricyclo[10.2.2.03,8]hexadecan-11-yl]methyl acetate (PubChem CID 90352093) has the molecular formula C26H36O17 and a molecular weight of 620.56 g/mol. Its IUPAC name is [(1R,4S,5R,6R,8R,11R,12R,15S,16S)-4,5,12,15,16-pentaacetyloxy-6-methoxy-2,7,10,14-tetraoxatricyclo[10.2.2.03,8]hexadecan-11-yl]methyl acetate.
| Compound Name | [(1R,4S,5R,6R,8R,11R,12R,15S,16S)-4,5,12,15,16-pentaacetyloxy-6-methoxy-2,7,10,14-tetraoxatricyclo[10.2.2.03,8]hexadecan-11-yl]methyl acetate |
|---|---|
| PubChem CID | 90352093 |
| Molecular Formula | C26H36O17 |
| Molecular Weight | 620.56 g/mol |
| Exact Mass | 620.20 |
| IUPAC Name | [(1R,4S,5R,6R,8R,11R,12R,15S,16S)-4,5,12,15,16-pentaacetyloxy-6-methoxy-2,7,10,14-tetraoxatricyclo[10.2.2.03,8]hexadecan-11-yl]methyl acetate |
| SMILES | CO[C@@H]1O[C@@H]2CO[C@H](COC(C)=O)[C@]3(OC(C)=O)CO[C@H](OC2[C@H](OC(C)=O)[C@H]1OC(C)=O)[C@@H](OC(C)=O)[C@@H]3OC(C)=O |
| InChI | InChI=1S/C26H36O17/c1-11(27)34-9-18-26(43-16(6)32)10-36-25(22(39-14(4)30)23(26)40-15(5)31)42-19-17(8-35-18)41-24(33-7)21(38-13(3)29)20(19)37-12(2)28/h17-25H,8-10H2,1-7H3/t17-,18-,19?,20+,21-,22+,23+,24-,25-,26-/m1/s1 |
| InChIKey | QMSNTMBMYTZTTC-BFTYOALFSA-N |
| XLogP | -0.91 |
| TPSA | 203.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.56 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|