About 5-(6,7-dimethylquinazolin-4-yl)oxy-4-fluoro-2-methyl-N-propylindole-1-carboxamide
5-(6,7-dimethylquinazolin-4-yl)oxy-4-fluoro-2-methyl-N-propylindole-1-carboxamide (PubChem CID 90352341) has the molecular formula C23H23FN4O2
and a molecular weight of 406.46 g/mol. Its IUPAC name is 5-(6,7-dimethylquinazolin-4-yl)oxy-4-fluoro-2-methyl-N-propylindole-1-carboxamide.
Molecular Properties
| Compound Name | 5-(6,7-dimethylquinazolin-4-yl)oxy-4-fluoro-2-methyl-N-propylindole-1-carboxamide |
| PubChem CID | 90352341 |
| Molecular Formula | C23H23FN4O2 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 5-(6,7-dimethylquinazolin-4-yl)oxy-4-fluoro-2-methyl-N-propylindole-1-carboxamide |
| SMILES | CCCNC(=O)n1c(C)cc2c(F)c(Oc3ncnc4cc(C)c(C)cc34)ccc21 |
| InChI | InChI=1S/C23H23FN4O2/c1-5-8-25-23(29)28-15(4)11-17-19(28)6-7-20(21(17)24)30-22-16-9-13(2)14(3)10-18(16)26-12-27-22/h6-7,9-12H,5,8H2,1-4H3,(H,25,29) |
| InChIKey | CPXPGRMWMRQAHT-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(6,7-dimethylquinazolin-4-yl)oxy-4-fluoro-2-methyl-N-propylindole-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(6,7-dimethylquinazolin-4-yl)oxy-4-fluoro-2-methyl-N-propylindole-1-carboxamide?
The IUPAC name of 5-(6,7-dimethylquinazolin-4-yl)oxy-4-fluoro-2-methyl-N-propylindole-1-carboxamide (CID 90352341) is 5-(6,7-dimethylquinazolin-4-yl)oxy-4-fluoro-2-methyl-N-propylindole-1-carboxamide.
What is the SMILES notation for 5-(6,7-dimethylquinazolin-4-yl)oxy-4-fluoro-2-methyl-N-propylindole-1-carboxamide?
The canonical SMILES for 5-(6,7-dimethylquinazolin-4-yl)oxy-4-fluoro-2-methyl-N-propylindole-1-carboxamide is CCCNC(=O)n1c(C)cc2c(F)c(Oc3ncnc4cc(C)c(C)cc34)ccc21.
What is the InChIKey of 5-(6,7-dimethylquinazolin-4-yl)oxy-4-fluoro-2-methyl-N-propylindole-1-carboxamide?
The InChIKey is CPXPGRMWMRQAHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23FN4O2/c1-5-8-25-23(29)28-15(4)11-17-19(28)6-7-20(21(17)24)30-22-16-9-13(2)14(3)10-18(16)26-12-27-22/h6-7,9-12H,5,8H2,1-4H3,(H,25,29).
What are the key properties of 5-(6,7-dimethylquinazolin-4-yl)oxy-4-fluoro-2-methyl-N-propylindole-1-carboxamide?
5-(6,7-dimethylquinazolin-4-yl)oxy-4-fluoro-2-methyl-N-propylindole-1-carboxamide has a molecular weight of 406.46 g/mol, XLogP of 5.41, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(6,7-dimethylquinazolin-4-yl)oxy-4-fluoro-2-methyl-N-propylindole-1-carboxamide is sourced from PubChem (CID 90352341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).