About (3S)-2-[(2S)-2-azido-1,3-dihydroxypropoxy]butane-1,3-diol
(3S)-2-[(2S)-2-azido-1,3-dihydroxypropoxy]butane-1,3-diol (PubChem CID 90352756) has the molecular formula C7H15N3O5
and a molecular weight of 221.21 g/mol. Its IUPAC name is (3S)-2-[(2S)-2-azido-1,3-dihydroxypropoxy]butane-1,3-diol.
Molecular Properties
| Compound Name | (3S)-2-[(2S)-2-azido-1,3-dihydroxypropoxy]butane-1,3-diol |
| PubChem CID | 90352756 |
| Molecular Formula | C7H15N3O5 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | (3S)-2-[(2S)-2-azido-1,3-dihydroxypropoxy]butane-1,3-diol |
| SMILES | C[C@H](O)C(CO)OC(O)[C@H](CO)N=[N+]=[N-] |
| InChI | InChI=1S/C7H15N3O5/c1-4(13)6(3-12)15-7(14)5(2-11)9-10-8/h4-7,11-14H,2-3H2,1H3/t4-,5-,6?,7?/m0/s1 |
| InChIKey | KTLLNOXEALDUMT-USEPMLCBSA-N |
| XLogP | -1.27 |
| TPSA | 138.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (3S)-2-[(2S)-2-azido-1,3-dihydroxypropoxy]butane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-2-[(2S)-2-azido-1,3-dihydroxypropoxy]butane-1,3-diol?
The IUPAC name of (3S)-2-[(2S)-2-azido-1,3-dihydroxypropoxy]butane-1,3-diol (CID 90352756) is (3S)-2-[(2S)-2-azido-1,3-dihydroxypropoxy]butane-1,3-diol.
What is the SMILES notation for (3S)-2-[(2S)-2-azido-1,3-dihydroxypropoxy]butane-1,3-diol?
The canonical SMILES for (3S)-2-[(2S)-2-azido-1,3-dihydroxypropoxy]butane-1,3-diol is C[C@H](O)C(CO)OC(O)[C@H](CO)N=[N+]=[N-].
What is the InChIKey of (3S)-2-[(2S)-2-azido-1,3-dihydroxypropoxy]butane-1,3-diol?
The InChIKey is KTLLNOXEALDUMT-USEPMLCBSA-N. The full InChI is InChI=1S/C7H15N3O5/c1-4(13)6(3-12)15-7(14)5(2-11)9-10-8/h4-7,11-14H,2-3H2,1H3/t4-,5-,6?,7?/m0/s1.
What are the key properties of (3S)-2-[(2S)-2-azido-1,3-dihydroxypropoxy]butane-1,3-diol?
(3S)-2-[(2S)-2-azido-1,3-dihydroxypropoxy]butane-1,3-diol has a molecular weight of 221.21 g/mol, XLogP of -1.27, 7 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-2-[(2S)-2-azido-1,3-dihydroxypropoxy]butane-1,3-diol is sourced from PubChem (CID 90352756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).