C11H19NO2 — CID 90352815
tert-butyl N-(4-methylpenta-1,3-dien-2-yl)carbamate (PubChem CID 90352815) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is tert-butyl N-(4-methylpenta-1,3-dien-2-yl)carbamate.
| Compound Name | tert-butyl N-(4-methylpenta-1,3-dien-2-yl)carbamate |
|---|---|
| PubChem CID | 90352815 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | tert-butyl N-(4-methylpenta-1,3-dien-2-yl)carbamate |
| SMILES | C=C(C=C(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H19NO2/c1-8(2)7-9(3)12-10(13)14-11(4,5)6/h7H,3H2,1-2,4-6H3,(H,12,13) |
| InChIKey | VDVJCQPFLNCHRF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|