C18H32O8S2 — CID 90352885
(2S,4R,5R)-4-butoxy-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(ethyldisulfanyl)methoxy]-5-hydroxyoxane-2-carboxylic acid (PubChem CID 90352885) has the molecular formula C18H32O8S2 and a molecular weight of 440.58 g/mol. Its IUPAC name is (2S,4R,5R)-4-butoxy-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(ethyldisulfanyl)methoxy]-5-hydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,4R,5R)-4-butoxy-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(ethyldisulfanyl)methoxy]-5-hydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 90352885 |
| Molecular Formula | C18H32O8S2 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | (2S,4R,5R)-4-butoxy-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(ethyldisulfanyl)methoxy]-5-hydroxyoxane-2-carboxylic acid |
| SMILES | CCCCO[C@@H]1C[C@](OCSSCC)(C(=O)O)OC([C@H]2COC(C)(C)O2)[C@@H]1O |
| InChI | InChI=1S/C18H32O8S2/c1-5-7-8-22-12-9-18(16(20)21,24-11-28-27-6-2)26-15(14(12)19)13-10-23-17(3,4)25-13/h12-15,19H,5-11H2,1-4H3,(H,20,21)/t12-,13-,14-,15?,18-/m1/s1 |
| InChIKey | BASKIILPHHXCKX-KZVCCUMOSA-N |
| XLogP | 2.63 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|