C17H27NO7 — CID 90352937
methyl (2S)-2-[acetyloxymethyl-[(1R,2R,5R)-2,5-dimethylcyclohexyl]oxycarbonylamino]-4-oxobutanoate (PubChem CID 90352937) has the molecular formula C17H27NO7 and a molecular weight of 357.40 g/mol. Its IUPAC name is methyl (2S)-2-[acetyloxymethyl-[(1R,2R,5R)-2,5-dimethylcyclohexyl]oxycarbonylamino]-4-oxobutanoate.
| Compound Name | methyl (2S)-2-[acetyloxymethyl-[(1R,2R,5R)-2,5-dimethylcyclohexyl]oxycarbonylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 90352937 |
| Molecular Formula | C17H27NO7 |
| Molecular Weight | 357.40 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | methyl (2S)-2-[acetyloxymethyl-[(1R,2R,5R)-2,5-dimethylcyclohexyl]oxycarbonylamino]-4-oxobutanoate |
| SMILES | COC(=O)[C@H](CC=O)N(COC(C)=O)C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C |
| InChI | InChI=1S/C17H27NO7/c1-11-5-6-12(2)15(9-11)25-17(22)18(10-24-13(3)20)14(7-8-19)16(21)23-4/h8,11-12,14-15H,5-7,9-10H2,1-4H3/t11-,12-,14+,15-/m1/s1 |
| InChIKey | GAQRSALHWLFFDW-RJZRQDKASA-N |
| XLogP | 1.90 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|