C22H40O9 — CID 90352942
methyl (2R,4R,5R)-6-[(1R)-2-acetyloxy-1-hydroxyethyl]-2-(2,2-dimethylnonoxy)-4,5-dihydroxyoxane-2-carboxylate (PubChem CID 90352942) has the molecular formula C22H40O9 and a molecular weight of 448.55 g/mol. Its IUPAC name is methyl (2R,4R,5R)-6-[(1R)-2-acetyloxy-1-hydroxyethyl]-2-(2,2-dimethylnonoxy)-4,5-dihydroxyoxane-2-carboxylate.
| Compound Name | methyl (2R,4R,5R)-6-[(1R)-2-acetyloxy-1-hydroxyethyl]-2-(2,2-dimethylnonoxy)-4,5-dihydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 90352942 |
| Molecular Formula | C22H40O9 |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | methyl (2R,4R,5R)-6-[(1R)-2-acetyloxy-1-hydroxyethyl]-2-(2,2-dimethylnonoxy)-4,5-dihydroxyoxane-2-carboxylate |
| SMILES | CCCCCCCC(C)(C)CO[C@]1(C(=O)OC)C[C@@H](O)[C@@H](O)C([C@H](O)COC(C)=O)O1 |
| InChI | InChI=1S/C22H40O9/c1-6-7-8-9-10-11-21(3,4)14-30-22(20(27)28-5)12-16(24)18(26)19(31-22)17(25)13-29-15(2)23/h16-19,24-26H,6-14H2,1-5H3/t16-,17-,18-,19?,22-/m1/s1 |
| InChIKey | NWTZUVNEGAJLSO-WHGZXNJKSA-N |
| XLogP | 1.69 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|