C24H21NO4 — CID 90353210
methyl 5-[4-(2,6-dimethoxyphenyl)phenyl]-1H-indole-3-carboxylate (PubChem CID 90353210) has the molecular formula C24H21NO4 and a molecular weight of 387.44 g/mol. Its IUPAC name is methyl 5-[4-(2,6-dimethoxyphenyl)phenyl]-1H-indole-3-carboxylate.
| Compound Name | methyl 5-[4-(2,6-dimethoxyphenyl)phenyl]-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 90353210 |
| Molecular Formula | C24H21NO4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | methyl 5-[4-(2,6-dimethoxyphenyl)phenyl]-1H-indole-3-carboxylate |
| SMILES | COC(=O)c1c[nH]c2ccc(-c3ccc(-c4c(OC)cccc4OC)cc3)cc12 |
| InChI | InChI=1S/C24H21NO4/c1-27-21-5-4-6-22(28-2)23(21)16-9-7-15(8-10-16)17-11-12-20-18(13-17)19(14-25-20)24(26)29-3/h4-14,25H,1-3H3 |
| InChIKey | PHLOHDWFAOCCTH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |