About (1-methylimidazol-4-yl) N-(3-azabicyclo[3.1.0]hexan-6-ylmethyl)-N-[2-(4-chlorophenyl)ethyl]carbamate
(1-methylimidazol-4-yl) N-(3-azabicyclo[3.1.0]hexan-6-ylmethyl)-N-[2-(4-chlorophenyl)ethyl]carbamate (PubChem CID 90353493) has the molecular formula C19H23ClN4O2
and a molecular weight of 374.87 g/mol. Its IUPAC name is (1-methylimidazol-4-yl) N-(3-azabicyclo[3.1.0]hexan-6-ylmethyl)-N-[2-(4-chlorophenyl)ethyl]carbamate.
Molecular Properties
| Compound Name | (1-methylimidazol-4-yl) N-(3-azabicyclo[3.1.0]hexan-6-ylmethyl)-N-[2-(4-chlorophenyl)ethyl]carbamate |
| PubChem CID | 90353493 |
| Molecular Formula | C19H23ClN4O2 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (1-methylimidazol-4-yl) N-(3-azabicyclo[3.1.0]hexan-6-ylmethyl)-N-[2-(4-chlorophenyl)ethyl]carbamate |
| SMILES | Cn1cnc(OC(=O)N(CCc2ccc(Cl)cc2)CC2C3CNCC32)c1 |
| InChI | InChI=1S/C19H23ClN4O2/c1-23-11-18(22-12-23)26-19(25)24(10-17-15-8-21-9-16(15)17)7-6-13-2-4-14(20)5-3-13/h2-5,11-12,15-17,21H,6-10H2,1H3 |
| InChIKey | CQXHGRCKMBDNNC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-methylimidazol-4-yl) N-(3-azabicyclo[3.1.0]hexan-6-ylmethyl)-N-[2-(4-chlorophenyl)ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylimidazol-4-yl) N-(3-azabicyclo[3.1.0]hexan-6-ylmethyl)-N-[2-(4-chlorophenyl)ethyl]carbamate?
The IUPAC name of (1-methylimidazol-4-yl) N-(3-azabicyclo[3.1.0]hexan-6-ylmethyl)-N-[2-(4-chlorophenyl)ethyl]carbamate (CID 90353493) is (1-methylimidazol-4-yl) N-(3-azabicyclo[3.1.0]hexan-6-ylmethyl)-N-[2-(4-chlorophenyl)ethyl]carbamate.
What is the SMILES notation for (1-methylimidazol-4-yl) N-(3-azabicyclo[3.1.0]hexan-6-ylmethyl)-N-[2-(4-chlorophenyl)ethyl]carbamate?
The canonical SMILES for (1-methylimidazol-4-yl) N-(3-azabicyclo[3.1.0]hexan-6-ylmethyl)-N-[2-(4-chlorophenyl)ethyl]carbamate is Cn1cnc(OC(=O)N(CCc2ccc(Cl)cc2)CC2C3CNCC32)c1.
What is the InChIKey of (1-methylimidazol-4-yl) N-(3-azabicyclo[3.1.0]hexan-6-ylmethyl)-N-[2-(4-chlorophenyl)ethyl]carbamate?
The InChIKey is CQXHGRCKMBDNNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23ClN4O2/c1-23-11-18(22-12-23)26-19(25)24(10-17-15-8-21-9-16(15)17)7-6-13-2-4-14(20)5-3-13/h2-5,11-12,15-17,21H,6-10H2,1H3.
What are the key properties of (1-methylimidazol-4-yl) N-(3-azabicyclo[3.1.0]hexan-6-ylmethyl)-N-[2-(4-chlorophenyl)ethyl]carbamate?
(1-methylimidazol-4-yl) N-(3-azabicyclo[3.1.0]hexan-6-ylmethyl)-N-[2-(4-chlorophenyl)ethyl]carbamate has a molecular weight of 374.87 g/mol, XLogP of 2.58, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylimidazol-4-yl) N-(3-azabicyclo[3.1.0]hexan-6-ylmethyl)-N-[2-(4-chlorophenyl)ethyl]carbamate is sourced from PubChem (CID 90353493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).