About [3-(3,3,3-trifluoropropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methanamine
[3-(3,3,3-trifluoropropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methanamine (PubChem CID 90353584) has the molecular formula C9H15F3N2
and a molecular weight of 208.23 g/mol. Its IUPAC name is [3-(3,3,3-trifluoropropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methanamine.
Molecular Properties
| Compound Name | [3-(3,3,3-trifluoropropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methanamine |
| PubChem CID | 90353584 |
| Molecular Formula | C9H15F3N2 |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | [3-(3,3,3-trifluoropropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methanamine |
| SMILES | NCC1C2CN(CCC(F)(F)F)CC12 |
| InChI | InChI=1S/C9H15F3N2/c10-9(11,12)1-2-14-4-7-6(3-13)8(7)5-14/h6-8H,1-5,13H2 |
| InChIKey | CGHDGQPDKRIYOB-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [3-(3,3,3-trifluoropropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3,3,3-trifluoropropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methanamine?
The IUPAC name of [3-(3,3,3-trifluoropropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methanamine (CID 90353584) is [3-(3,3,3-trifluoropropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methanamine.
What is the SMILES notation for [3-(3,3,3-trifluoropropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methanamine?
The canonical SMILES for [3-(3,3,3-trifluoropropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methanamine is NCC1C2CN(CCC(F)(F)F)CC12.
What is the InChIKey of [3-(3,3,3-trifluoropropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methanamine?
The InChIKey is CGHDGQPDKRIYOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3N2/c10-9(11,12)1-2-14-4-7-6(3-13)8(7)5-14/h6-8H,1-5,13H2.
What are the key properties of [3-(3,3,3-trifluoropropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methanamine?
[3-(3,3,3-trifluoropropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methanamine has a molecular weight of 208.23 g/mol, XLogP of 1.08, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3,3,3-trifluoropropyl)-3-azabicyclo[3.1.0]hexan-6-yl]methanamine is sourced from PubChem (CID 90353584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).