C16H32N4O8 — CID 90354128
2-methyl-2-[[2-methyl-1-oxo-1-(1,1,4-trihydroxybutan-2-ylamino)propan-2-yl]diazenyl]-N-(1,1,4-trihydroxybutan-2-yl)propanamide (PubChem CID 90354128) has the molecular formula C16H32N4O8 and a molecular weight of 408.45 g/mol. Its IUPAC name is 2-methyl-2-[[2-methyl-1-oxo-1-(1,1,4-trihydroxybutan-2-ylamino)propan-2-yl]diazenyl]-N-(1,1,4-trihydroxybutan-2-yl)propanamide.
| Compound Name | 2-methyl-2-[[2-methyl-1-oxo-1-(1,1,4-trihydroxybutan-2-ylamino)propan-2-yl]diazenyl]-N-(1,1,4-trihydroxybutan-2-yl)propanamide |
|---|---|
| PubChem CID | 90354128 |
| Molecular Formula | C16H32N4O8 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 2-methyl-2-[[2-methyl-1-oxo-1-(1,1,4-trihydroxybutan-2-ylamino)propan-2-yl]diazenyl]-N-(1,1,4-trihydroxybutan-2-yl)propanamide |
| SMILES | CC(C)(/N=N/C(C)(C)C(=O)NC(CCO)C(O)O)C(=O)NC(CCO)C(O)O |
| InChI | InChI=1S/C16H32N4O8/c1-15(2,13(27)17-9(5-7-21)11(23)24)19-20-16(3,4)14(28)18-10(6-8-22)12(25)26/h9-12,21-26H,5-8H2,1-4H3,(H,17,27)(H,18,28)/b20-19+ |
| InChIKey | RYOOMHZXUNVCGB-FMQUCBEESA-N |
| XLogP | -2.65 |
| TPSA | 204.30 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|