C21H22FN3O2 — CID 90354819
5-[1-(2,6-dimethyl-4-pyridinyl)-6-methyl-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepin-3-yl]-2-fluorophenol (PubChem CID 90354819) has the molecular formula C21H22FN3O2 and a molecular weight of 367.42 g/mol. Its IUPAC name is 5-[1-(2,6-dimethyl-4-pyridinyl)-6-methyl-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepin-3-yl]-2-fluorophenol.
| Compound Name | 5-[1-(2,6-dimethyl-4-pyridinyl)-6-methyl-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepin-3-yl]-2-fluorophenol |
|---|---|
| PubChem CID | 90354819 |
| Molecular Formula | C21H22FN3O2 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 5-[1-(2,6-dimethyl-4-pyridinyl)-6-methyl-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepin-3-yl]-2-fluorophenol |
| SMILES | Cc1cc(-c2nc(-c3ccc(F)c(O)c3)n3c2CCOC(C)C3)cc(C)n1 |
| InChI | InChI=1S/C21H22FN3O2/c1-12-8-16(9-13(2)23-12)20-18-6-7-27-14(3)11-25(18)21(24-20)15-4-5-17(22)19(26)10-15/h4-5,8-10,14,26H,6-7,11H2,1-3H3 |
| InChIKey | OTUDMSUXCYBWDM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |