C11H16OSi — CID 90354910
1,1,3,3-tetramethyl-2,1-benzoxasilole (PubChem CID 90354910) has the molecular formula C11H16OSi and a molecular weight of 192.33 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2,1-benzoxasilole.
| Compound Name | 1,1,3,3-tetramethyl-2,1-benzoxasilole |
|---|---|
| PubChem CID | 90354910 |
| Molecular Formula | C11H16OSi |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 1,1,3,3-tetramethyl-2,1-benzoxasilole |
| SMILES | CC1(C)O[Si](C)(C)c2ccccc21 |
| InChI | InChI=1S/C11H16OSi/c1-11(2)9-7-5-6-8-10(9)13(3,4)12-11/h5-8H,1-4H3 |
| InChIKey | WPWDAIJDHPHVEW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|