C38H80O5Si4 — CID 90354928
[(2R,3R,4R,5R,6R)-6-(2-trimethylsilylethynyl)-3,4,5-tris[tri(propan-2-yl)silyloxy]oxan-2-yl]methanol (PubChem CID 90354928) has the molecular formula C38H80O5Si4 and a molecular weight of 729.40 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-6-(2-trimethylsilylethynyl)-3,4,5-tris[tri(propan-2-yl)silyloxy]oxan-2-yl]methanol.
| Compound Name | [(2R,3R,4R,5R,6R)-6-(2-trimethylsilylethynyl)-3,4,5-tris[tri(propan-2-yl)silyloxy]oxan-2-yl]methanol |
|---|---|
| PubChem CID | 90354928 |
| Molecular Formula | C38H80O5Si4 |
| Molecular Weight | 729.40 g/mol |
| Exact Mass | 728.51 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-6-(2-trimethylsilylethynyl)-3,4,5-tris[tri(propan-2-yl)silyloxy]oxan-2-yl]methanol |
| SMILES | CC(C)[Si](O[C@@H]1[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C#C[Si](C)(C)C)O[C@H](CO)[C@H]1O[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C38H80O5Si4/c1-25(2)45(26(3)4,27(5)6)41-36-34(22-23-44(19,20)21)40-35(24-39)37(42-46(28(7)8,29(9)10)30(11)12)38(36)43-47(31(13)14,32(15)16)33(17)18/h25-39H,24H2,1-21H3/t34-,35-,36-,37-,38-/m1/s1 |
| InChIKey | SABOPVNUYGAYGK-OHTWKVNYSA-N |
| XLogP | 11.31 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.40 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|