C24H27N7O3 — CID 90355070
5-[[(1R,2S)-2-aminocyclohexyl]amino]-3-[[6-methyl-5-(3-nitrophenyl)-2-pyridinyl]amino]pyridine-2-carboxamide (PubChem CID 90355070) has the molecular formula C24H27N7O3 and a molecular weight of 461.53 g/mol. Its IUPAC name is 5-[[(1R,2S)-2-aminocyclohexyl]amino]-3-[[6-methyl-5-(3-nitrophenyl)-2-pyridinyl]amino]pyridine-2-carboxamide.
| Compound Name | 5-[[(1R,2S)-2-aminocyclohexyl]amino]-3-[[6-methyl-5-(3-nitrophenyl)-2-pyridinyl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 90355070 |
| Molecular Formula | C24H27N7O3 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 5-[[(1R,2S)-2-aminocyclohexyl]amino]-3-[[6-methyl-5-(3-nitrophenyl)-2-pyridinyl]amino]pyridine-2-carboxamide |
| SMILES | Cc1nc(Nc2cc(N[C@@H]3CCCC[C@@H]3N)cnc2C(N)=O)ccc1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H27N7O3/c1-14-18(15-5-4-6-17(11-15)31(33)34)9-10-22(28-14)30-21-12-16(13-27-23(21)24(26)32)29-20-8-3-2-7-19(20)25/h4-6,9-13,19-20,29H,2-3,7-8,25H2,1H3,(H2,26,32)(H,28,30)/t19-,20+/m0/s1 |
| InChIKey | HPMYXJSFYHPNMD-VQTJNVASSA-N |
| XLogP | 3.88 |
| TPSA | 162.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|