C15H13BrClF3N2O2 — CID 90355081
1-bromo-3-[4-chloro-3-(2,2,2-trifluoroethoxy)phenyl]-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepine (PubChem CID 90355081) has the molecular formula C15H13BrClF3N2O2 and a molecular weight of 425.63 g/mol. Its IUPAC name is 1-bromo-3-[4-chloro-3-(2,2,2-trifluoroethoxy)phenyl]-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepine.
| Compound Name | 1-bromo-3-[4-chloro-3-(2,2,2-trifluoroethoxy)phenyl]-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepine |
|---|---|
| PubChem CID | 90355081 |
| Molecular Formula | C15H13BrClF3N2O2 |
| Molecular Weight | 425.63 g/mol |
| Exact Mass | 423.98 |
| IUPAC Name | 1-bromo-3-[4-chloro-3-(2,2,2-trifluoroethoxy)phenyl]-5,6,8,9-tetrahydroimidazo[1,5-d][1,4]oxazepine |
| SMILES | FC(F)(F)COc1cc(-c2nc(Br)c3n2CCOCC3)ccc1Cl |
| InChI | InChI=1S/C15H13BrClF3N2O2/c16-13-11-3-5-23-6-4-22(11)14(21-13)9-1-2-10(17)12(7-9)24-8-15(18,19)20/h1-2,7H,3-6,8H2 |
| InChIKey | VPTDPLFIGQKOEL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.63 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |