About 1-(3,4-dimethoxyphenyl)-4-pyrimidin-2-ylbutane-1,4-dione
1-(3,4-dimethoxyphenyl)-4-pyrimidin-2-ylbutane-1,4-dione (PubChem CID 90355171) has the molecular formula C16H16N2O4
and a molecular weight of 300.31 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-4-pyrimidin-2-ylbutane-1,4-dione.
Molecular Properties
| Compound Name | 1-(3,4-dimethoxyphenyl)-4-pyrimidin-2-ylbutane-1,4-dione |
| PubChem CID | 90355171 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-4-pyrimidin-2-ylbutane-1,4-dione |
| SMILES | COc1ccc(C(=O)CCC(=O)c2ncccn2)cc1OC |
| InChI | InChI=1S/C16H16N2O4/c1-21-14-7-4-11(10-15(14)22-2)12(19)5-6-13(20)16-17-8-3-9-18-16/h3-4,7-10H,5-6H2,1-2H3 |
| InChIKey | UUBHWQNGPOOIOM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(3,4-dimethoxyphenyl)-4-pyrimidin-2-ylbutane-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dimethoxyphenyl)-4-pyrimidin-2-ylbutane-1,4-dione?
The IUPAC name of 1-(3,4-dimethoxyphenyl)-4-pyrimidin-2-ylbutane-1,4-dione (CID 90355171) is 1-(3,4-dimethoxyphenyl)-4-pyrimidin-2-ylbutane-1,4-dione.
What is the SMILES notation for 1-(3,4-dimethoxyphenyl)-4-pyrimidin-2-ylbutane-1,4-dione?
The canonical SMILES for 1-(3,4-dimethoxyphenyl)-4-pyrimidin-2-ylbutane-1,4-dione is COc1ccc(C(=O)CCC(=O)c2ncccn2)cc1OC.
What is the InChIKey of 1-(3,4-dimethoxyphenyl)-4-pyrimidin-2-ylbutane-1,4-dione?
The InChIKey is UUBHWQNGPOOIOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O4/c1-21-14-7-4-11(10-15(14)22-2)12(19)5-6-13(20)16-17-8-3-9-18-16/h3-4,7-10H,5-6H2,1-2H3.
What are the key properties of 1-(3,4-dimethoxyphenyl)-4-pyrimidin-2-ylbutane-1,4-dione?
1-(3,4-dimethoxyphenyl)-4-pyrimidin-2-ylbutane-1,4-dione has a molecular weight of 300.31 g/mol, XLogP of 2.34, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dimethoxyphenyl)-4-pyrimidin-2-ylbutane-1,4-dione is sourced from PubChem (CID 90355171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).