C28H38N10O4S3+2 — CID 90355378
bis[3-[N-ethyl-4-[(4-methyl-1,2,4-thiadiazol-4-ium-5-yl)diazenyl]anilino]propyl] sulfate (PubChem CID 90355378) has the molecular formula C28H38N10O4S3+2 and a molecular weight of 674.88 g/mol. Its IUPAC name is bis[3-[N-ethyl-4-[(4-methyl-1,2,4-thiadiazol-4-ium-5-yl)diazenyl]anilino]propyl] sulfate.
| Compound Name | bis[3-[N-ethyl-4-[(4-methyl-1,2,4-thiadiazol-4-ium-5-yl)diazenyl]anilino]propyl] sulfate |
|---|---|
| PubChem CID | 90355378 |
| Molecular Formula | C28H38N10O4S3+2 |
| Molecular Weight | 674.88 g/mol |
| Exact Mass | 674.22 |
| IUPAC Name | bis[3-[N-ethyl-4-[(4-methyl-1,2,4-thiadiazol-4-ium-5-yl)diazenyl]anilino]propyl] sulfate |
| SMILES | CCN(CCCOS(=O)(=O)OCCCN(CC)c1ccc(/N=N/c2snc[n+]2C)cc1)c1ccc(/N=N/c2snc[n+]2C)cc1 |
| InChI | InChI=1S/C28H38N10O4S3/c1-5-37(25-13-9-23(10-14-25)31-33-27-35(3)21-29-43-27)17-7-19-41-45(39,40)42-20-8-18-38(6-2)26-15-11-24(12-16-26)32-34-28-36(4)22-30-44-28/h9-16,21-22H,5-8,17-20H2,1-4H3/q+2 |
| InChIKey | GKFBOMABDOAIQP-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 142.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.88 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|