(3,3-difluorocyclobutyl)methanesulfonyl chloride

C5H7ClF2O2S — CID 90355675

IUPAC(3,3-difluorocyclobutyl)methanesulfonyl chloride
SMILESO=S(=O)(Cl)CC1CC(F)(F)C1
InChIInChI=1S/C5H7ClF2O2S/c6-11(9,10)3-4-1-5(7,8)2-4/h4H,1-3H2
InChIKeyUUMFLEUTZDVHNQ-UHFFFAOYSA-N
MW204.62 g/mol
LogP1.60
Rot. Bonds2

About (3,3-difluorocyclobutyl)methanesulfonyl chloride

(3,3-difluorocyclobutyl)methanesulfonyl chloride (PubChem CID 90355675) has the molecular formula C5H7ClF2O2S and a molecular weight of 204.62 g/mol. Its IUPAC name is (3,3-difluorocyclobutyl)methanesulfonyl chloride.

Molecular Properties

Compound Name(3,3-difluorocyclobutyl)methanesulfonyl chloride
PubChem CID90355675
Molecular FormulaC5H7ClF2O2S
Molecular Weight204.62 g/mol
Exact Mass203.98
IUPAC Name(3,3-difluorocyclobutyl)methanesulfonyl chloride
SMILESO=S(=O)(Cl)CC1CC(F)(F)C1
InChIInChI=1S/C5H7ClF2O2S/c6-11(9,10)3-4-1-5(7,8)2-4/h4H,1-3H2
InChIKeyUUMFLEUTZDVHNQ-UHFFFAOYSA-N
XLogP1.60
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.62
LogP ≤ 51.60
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze (3,3-difluorocyclobutyl)methanesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3,3-Difluorocyclobutane-1-sulfonyl chloride
CID 58557426
(1-Fluorocyclobutyl)methanesulfonyl chloride
CID 119031264
3-(Difluoromethyl)cyclobutane-1-sulfonyl chloride
CID 118868806
(3-Fluorocyclobutyl)methanesulfonyl chloride
CID 126688657
(1-(Difluoromethyl)cyclobutyl)methanesulfonyl chloride
CID 84684212
2-(2,2-Difluorocyclopropyl)ethane-1-sulfonyl chloride
CID 122163794
(1-(Trifluoromethyl)cyclobutyl)methanesulfonyl chloride
CID 125424288
3-(Trifluoromethyl)cyclobutane-1-sulfonyl chloride
CID 131196495
[3-(Trifluoromethyl)cyclobutyl]methanesulfonyl chloride
CID 138987509
rac-((1R,2R)-2-(trifluoromethyl)cyclopropyl)methanesulfonyl chloride
CID 145915792
2-(3,3-Difluorocyclobutyl)ethane-1-sulfonyl chloride
CID 154578276
rac-((1R,2R)-2-(trifluoromethyl)cyclobutyl)methanesulfonyl chloride
CID 155820610

Frequently Asked Questions

What is the IUPAC name of (3,3-difluorocyclobutyl)methanesulfonyl chloride?
The IUPAC name of (3,3-difluorocyclobutyl)methanesulfonyl chloride (CID 90355675) is (3,3-difluorocyclobutyl)methanesulfonyl chloride.
What is the SMILES notation for (3,3-difluorocyclobutyl)methanesulfonyl chloride?
The canonical SMILES for (3,3-difluorocyclobutyl)methanesulfonyl chloride is O=S(=O)(Cl)CC1CC(F)(F)C1.
What is the InChIKey of (3,3-difluorocyclobutyl)methanesulfonyl chloride?
The InChIKey is UUMFLEUTZDVHNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClF2O2S/c6-11(9,10)3-4-1-5(7,8)2-4/h4H,1-3H2.
What are the key properties of (3,3-difluorocyclobutyl)methanesulfonyl chloride?
(3,3-difluorocyclobutyl)methanesulfonyl chloride has a molecular weight of 204.62 g/mol, XLogP of 1.60, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-difluorocyclobutyl)methanesulfonyl chloride is sourced from PubChem (CID 90355675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).