C18H15FN4O — CID 90356704
2-[4-fluoro-3-[(6-methyl-2-pyridin-3-ylpyrimidin-4-yl)amino]phenyl]acetaldehyde (PubChem CID 90356704) has the molecular formula C18H15FN4O and a molecular weight of 322.34 g/mol. Its IUPAC name is 2-[4-fluoro-3-[(6-methyl-2-pyridin-3-ylpyrimidin-4-yl)amino]phenyl]acetaldehyde.
| Compound Name | 2-[4-fluoro-3-[(6-methyl-2-pyridin-3-ylpyrimidin-4-yl)amino]phenyl]acetaldehyde |
|---|---|
| PubChem CID | 90356704 |
| Molecular Formula | C18H15FN4O |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 2-[4-fluoro-3-[(6-methyl-2-pyridin-3-ylpyrimidin-4-yl)amino]phenyl]acetaldehyde |
| SMILES | Cc1cc(Nc2cc(CC=O)ccc2F)nc(-c2cccnc2)n1 |
| InChI | InChI=1S/C18H15FN4O/c1-12-9-17(23-18(21-12)14-3-2-7-20-11-14)22-16-10-13(6-8-24)4-5-15(16)19/h2-5,7-11H,6H2,1H3,(H,21,22,23) |
| InChIKey | OGTQNVJNPPDWAR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|