C27H32N2O4 — CID 90357101
3-[2-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]ethoxy]-7,8,9,10-tetrahydrobenzo[c]chromen-6-one (PubChem CID 90357101) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is 3-[2-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]ethoxy]-7,8,9,10-tetrahydrobenzo[c]chromen-6-one.
| Compound Name | 3-[2-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]ethoxy]-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 90357101 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 3-[2-[4-[(3-methoxyphenyl)methyl]piperazin-1-yl]ethoxy]-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
| SMILES | COc1cccc(CN2CCN(CCOc3ccc4c5c(c(=O)oc4c3)CCCC5)CC2)c1 |
| InChI | InChI=1S/C27H32N2O4/c1-31-21-6-4-5-20(17-21)19-29-13-11-28(12-14-29)15-16-32-22-9-10-24-23-7-2-3-8-25(23)27(30)33-26(24)18-22/h4-6,9-10,17-18H,2-3,7-8,11-16,19H2,1H3 |
| InChIKey | CACFQCMXTYRFGE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 55.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|