C29H16FN5S3 — CID 90357203
2-[[4-[10-[5-(2,2-dicyanoethenyl)thiophen-2-yl]-7-propyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-3-fluorophenyl]methylidene]propanedinitrile (PubChem CID 90357203) has the molecular formula C29H16FN5S3 and a molecular weight of 549.68 g/mol. Its IUPAC name is 2-[[4-[10-[5-(2,2-dicyanoethenyl)thiophen-2-yl]-7-propyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-3-fluorophenyl]methylidene]propanedinitrile.
| Compound Name | 2-[[4-[10-[5-(2,2-dicyanoethenyl)thiophen-2-yl]-7-propyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-3-fluorophenyl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 90357203 |
| Molecular Formula | C29H16FN5S3 |
| Molecular Weight | 549.68 g/mol |
| Exact Mass | 549.06 |
| IUPAC Name | 2-[[4-[10-[5-(2,2-dicyanoethenyl)thiophen-2-yl]-7-propyl-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-3-fluorophenyl]methylidene]propanedinitrile |
| SMILES | CCCn1c2cc(-c3ccc(C=C(C#N)C#N)s3)sc2c2sc(-c3ccc(C=C(C#N)C#N)cc3F)cc21 |
| InChI | InChI=1S/C29H16FN5S3/c1-2-7-35-23-11-26(21-5-3-17(10-22(21)30)8-18(13-31)14-32)37-28(23)29-24(35)12-27(38-29)25-6-4-20(36-25)9-19(15-33)16-34/h3-6,8-12H,2,7H2,1H3 |
| InChIKey | CGWBOHZFXDQQGF-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 100.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.68 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|