C25H22Cl2N2O3 — CID 90357357
4-[[(2R,5S,6R)-5,6-bis(4-chlorophenyl)-4-methyl-3-oxomorpholin-2-yl]methyl]benzamide (PubChem CID 90357357) has the molecular formula C25H22Cl2N2O3 and a molecular weight of 469.37 g/mol. Its IUPAC name is 4-[[(2R,5S,6R)-5,6-bis(4-chlorophenyl)-4-methyl-3-oxomorpholin-2-yl]methyl]benzamide.
| Compound Name | 4-[[(2R,5S,6R)-5,6-bis(4-chlorophenyl)-4-methyl-3-oxomorpholin-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 90357357 |
| Molecular Formula | C25H22Cl2N2O3 |
| Molecular Weight | 469.37 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 4-[[(2R,5S,6R)-5,6-bis(4-chlorophenyl)-4-methyl-3-oxomorpholin-2-yl]methyl]benzamide |
| SMILES | CN1C(=O)[C@@H](Cc2ccc(C(N)=O)cc2)O[C@H](c2ccc(Cl)cc2)[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H22Cl2N2O3/c1-29-22(16-6-10-19(26)11-7-16)23(17-8-12-20(27)13-9-17)32-21(25(29)31)14-15-2-4-18(5-3-15)24(28)30/h2-13,21-23H,14H2,1H3,(H2,28,30)/t21-,22+,23-/m1/s1 |
| InChIKey | DUKKINYYQITDDA-XPWALMASSA-N |
| XLogP | 4.97 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.37 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |