About N-[(2R,3S)-2,3-bis(4-chlorophenyl)-5-oxomorpholin-4-yl]-N-(2-hydroxyethyl)pentanamide
N-[(2R,3S)-2,3-bis(4-chlorophenyl)-5-oxomorpholin-4-yl]-N-(2-hydroxyethyl)pentanamide (PubChem CID 90357477) has the molecular formula C23H26Cl2N2O4
and a molecular weight of 465.38 g/mol. Its IUPAC name is N-[(2R,3S)-2,3-bis(4-chlorophenyl)-5-oxomorpholin-4-yl]-N-(2-hydroxyethyl)pentanamide.
Molecular Properties
| Compound Name | N-[(2R,3S)-2,3-bis(4-chlorophenyl)-5-oxomorpholin-4-yl]-N-(2-hydroxyethyl)pentanamide |
| PubChem CID | 90357477 |
| Molecular Formula | C23H26Cl2N2O4 |
| Molecular Weight | 465.38 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | N-[(2R,3S)-2,3-bis(4-chlorophenyl)-5-oxomorpholin-4-yl]-N-(2-hydroxyethyl)pentanamide |
| SMILES | CCCCC(=O)N(CCO)N1C(=O)CO[C@H](c2ccc(Cl)cc2)[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H26Cl2N2O4/c1-2-3-4-20(29)26(13-14-28)27-21(30)15-31-23(17-7-11-19(25)12-8-17)22(27)16-5-9-18(24)10-6-16/h5-12,22-23,28H,2-4,13-15H2,1H3/t22-,23+/m0/s1 |
| InChIKey | URKYATFHRALSJK-XZOQPEGZSA-N |
| XLogP | 4.56 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 465.38 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(2R,3S)-2,3-bis(4-chlorophenyl)-5-oxomorpholin-4-yl]-N-(2-hydroxyethyl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R,3S)-2,3-bis(4-chlorophenyl)-5-oxomorpholin-4-yl]-N-(2-hydroxyethyl)pentanamide?
The IUPAC name of N-[(2R,3S)-2,3-bis(4-chlorophenyl)-5-oxomorpholin-4-yl]-N-(2-hydroxyethyl)pentanamide (CID 90357477) is N-[(2R,3S)-2,3-bis(4-chlorophenyl)-5-oxomorpholin-4-yl]-N-(2-hydroxyethyl)pentanamide.
What is the SMILES notation for N-[(2R,3S)-2,3-bis(4-chlorophenyl)-5-oxomorpholin-4-yl]-N-(2-hydroxyethyl)pentanamide?
The canonical SMILES for N-[(2R,3S)-2,3-bis(4-chlorophenyl)-5-oxomorpholin-4-yl]-N-(2-hydroxyethyl)pentanamide is CCCCC(=O)N(CCO)N1C(=O)CO[C@H](c2ccc(Cl)cc2)[C@@H]1c1ccc(Cl)cc1.
What is the InChIKey of N-[(2R,3S)-2,3-bis(4-chlorophenyl)-5-oxomorpholin-4-yl]-N-(2-hydroxyethyl)pentanamide?
The InChIKey is URKYATFHRALSJK-XZOQPEGZSA-N. The full InChI is InChI=1S/C23H26Cl2N2O4/c1-2-3-4-20(29)26(13-14-28)27-21(30)15-31-23(17-7-11-19(25)12-8-17)22(27)16-5-9-18(24)10-6-16/h5-12,22-23,28H,2-4,13-15H2,1H3/t22-,23+/m0/s1.
What are the key properties of N-[(2R,3S)-2,3-bis(4-chlorophenyl)-5-oxomorpholin-4-yl]-N-(2-hydroxyethyl)pentanamide?
N-[(2R,3S)-2,3-bis(4-chlorophenyl)-5-oxomorpholin-4-yl]-N-(2-hydroxyethyl)pentanamide has a molecular weight of 465.38 g/mol, XLogP of 4.56, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R,3S)-2,3-bis(4-chlorophenyl)-5-oxomorpholin-4-yl]-N-(2-hydroxyethyl)pentanamide is sourced from PubChem (CID 90357477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).