About 5H-chromen-8-amine
5H-chromen-8-amine (PubChem CID 90357645) has the molecular formula C9H9NO
and a molecular weight of 147.18 g/mol. Its IUPAC name is 5H-chromen-8-amine.
Molecular Properties
| Compound Name | 5H-chromen-8-amine |
| PubChem CID | 90357645 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 5H-chromen-8-amine |
| SMILES | NC1=C2OC=CC=C2CC=C1 |
| InChI | InChI=1S/C9H9NO/c10-8-5-1-3-7-4-2-6-11-9(7)8/h1-2,4-6H,3,10H2 |
| InChIKey | KXHHWBAEHOFNBP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5H-chromen-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-chromen-8-amine?
The IUPAC name of 5H-chromen-8-amine (CID 90357645) is 5H-chromen-8-amine.
What is the SMILES notation for 5H-chromen-8-amine?
The canonical SMILES for 5H-chromen-8-amine is NC1=C2OC=CC=C2CC=C1.
What is the InChIKey of 5H-chromen-8-amine?
The InChIKey is KXHHWBAEHOFNBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO/c10-8-5-1-3-7-4-2-6-11-9(7)8/h1-2,4-6H,3,10H2.
What are the key properties of 5H-chromen-8-amine?
5H-chromen-8-amine has a molecular weight of 147.18 g/mol, XLogP of 1.59, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-chromen-8-amine is sourced from PubChem (CID 90357645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).