C28H44O2 — CID 90358063
2,6-ditert-butyl-5-(2,4-ditert-butylphenyl)cyclohexa-2,4-diene-1,1-diol (PubChem CID 90358063) has the molecular formula C28H44O2 and a molecular weight of 412.66 g/mol. Its IUPAC name is 2,6-ditert-butyl-5-(2,4-ditert-butylphenyl)cyclohexa-2,4-diene-1,1-diol.
| Compound Name | 2,6-ditert-butyl-5-(2,4-ditert-butylphenyl)cyclohexa-2,4-diene-1,1-diol |
|---|---|
| PubChem CID | 90358063 |
| Molecular Formula | C28H44O2 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.33 |
| IUPAC Name | 2,6-ditert-butyl-5-(2,4-ditert-butylphenyl)cyclohexa-2,4-diene-1,1-diol |
| SMILES | CC(C)(C)C1=CC=C(c2ccc(C(C)(C)C)cc2C(C)(C)C)C(C(C)(C)C)C1(O)O |
| InChI | InChI=1S/C28H44O2/c1-24(2,3)18-13-14-19(21(17-18)25(4,5)6)20-15-16-22(26(7,8)9)28(29,30)23(20)27(10,11)12/h13-17,23,29-30H,1-12H3 |
| InChIKey | LYIIACWIVLPAHN-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|