C21H24Cl2N2O2 — CID 90358282
(5S,6R)-4-[(2R)-1-aminopentan-2-yl]-5,6-bis(4-chlorophenyl)morpholin-3-one (PubChem CID 90358282) has the molecular formula C21H24Cl2N2O2 and a molecular weight of 407.34 g/mol. Its IUPAC name is (5S,6R)-4-[(2R)-1-aminopentan-2-yl]-5,6-bis(4-chlorophenyl)morpholin-3-one.
| Compound Name | (5S,6R)-4-[(2R)-1-aminopentan-2-yl]-5,6-bis(4-chlorophenyl)morpholin-3-one |
|---|---|
| PubChem CID | 90358282 |
| Molecular Formula | C21H24Cl2N2O2 |
| Molecular Weight | 407.34 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | (5S,6R)-4-[(2R)-1-aminopentan-2-yl]-5,6-bis(4-chlorophenyl)morpholin-3-one |
| SMILES | CCC[C@H](CN)N1C(=O)CO[C@H](c2ccc(Cl)cc2)[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H24Cl2N2O2/c1-2-3-18(12-24)25-19(26)13-27-21(15-6-10-17(23)11-7-15)20(25)14-4-8-16(22)9-5-14/h4-11,18,20-21H,2-3,12-13,24H2,1H3/t18-,20+,21-/m1/s1 |
| InChIKey | HVSJWQOMQAUZJJ-HLAWJBBLSA-N |
| XLogP | 4.76 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.34 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |