C20H21F5N2OS — CID 90358294
N-ethyl-N'-[4-[4-fluoro-3-(1,1,2,2-tetrafluoroethylsulfanyl)phenoxy]-2,5-dimethylphenyl]-N-methylmethanimidamide (PubChem CID 90358294) has the molecular formula C20H21F5N2OS and a molecular weight of 432.46 g/mol. Its IUPAC name is N-ethyl-N'-[4-[4-fluoro-3-(1,1,2,2-tetrafluoroethylsulfanyl)phenoxy]-2,5-dimethylphenyl]-N-methylmethanimidamide.
| Compound Name | N-ethyl-N'-[4-[4-fluoro-3-(1,1,2,2-tetrafluoroethylsulfanyl)phenoxy]-2,5-dimethylphenyl]-N-methylmethanimidamide |
|---|---|
| PubChem CID | 90358294 |
| Molecular Formula | C20H21F5N2OS |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | N-ethyl-N'-[4-[4-fluoro-3-(1,1,2,2-tetrafluoroethylsulfanyl)phenoxy]-2,5-dimethylphenyl]-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(Oc2ccc(F)c(SC(F)(F)C(F)F)c2)cc1C |
| InChI | InChI=1S/C20H21F5N2OS/c1-5-27(4)11-26-16-8-13(3)17(9-12(16)2)28-14-6-7-15(21)18(10-14)29-20(24,25)19(22)23/h6-11,19H,5H2,1-4H3/b26-11+ |
| InChIKey | DNZDBXFXIPMWSV-KBKYJPHKSA-N |
| XLogP | 6.80 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|