About (4S)-6,6-dibromo-4-[dimethyl(2-methylpropyl)silyl]oxyhex-5-enoic acid
(4S)-6,6-dibromo-4-[dimethyl(2-methylpropyl)silyl]oxyhex-5-enoic acid (PubChem CID 90358327) has the molecular formula C12H22Br2O3Si
and a molecular weight of 402.20 g/mol. Its IUPAC name is (4S)-6,6-dibromo-4-[dimethyl(2-methylpropyl)silyl]oxyhex-5-enoic acid.
Molecular Properties
| Compound Name | (4S)-6,6-dibromo-4-[dimethyl(2-methylpropyl)silyl]oxyhex-5-enoic acid |
| PubChem CID | 90358327 |
| Molecular Formula | C12H22Br2O3Si |
| Molecular Weight | 402.20 g/mol |
| Exact Mass | 399.97 |
| IUPAC Name | (4S)-6,6-dibromo-4-[dimethyl(2-methylpropyl)silyl]oxyhex-5-enoic acid |
| SMILES | CC(C)C[Si](C)(C)O[C@H](C=C(Br)Br)CCC(=O)O |
| InChI | InChI=1S/C12H22Br2O3Si/c1-9(2)8-18(3,4)17-10(7-11(13)14)5-6-12(15)16/h7,9-10H,5-6,8H2,1-4H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | QJCJVKHGMGOPQD-JTQLQIEISA-N |
| XLogP | 4.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.20 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4S)-6,6-dibromo-4-[dimethyl(2-methylpropyl)silyl]oxyhex-5-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-6,6-dibromo-4-[dimethyl(2-methylpropyl)silyl]oxyhex-5-enoic acid?
The IUPAC name of (4S)-6,6-dibromo-4-[dimethyl(2-methylpropyl)silyl]oxyhex-5-enoic acid (CID 90358327) is (4S)-6,6-dibromo-4-[dimethyl(2-methylpropyl)silyl]oxyhex-5-enoic acid.
What is the SMILES notation for (4S)-6,6-dibromo-4-[dimethyl(2-methylpropyl)silyl]oxyhex-5-enoic acid?
The canonical SMILES for (4S)-6,6-dibromo-4-[dimethyl(2-methylpropyl)silyl]oxyhex-5-enoic acid is CC(C)C[Si](C)(C)O[C@H](C=C(Br)Br)CCC(=O)O.
What is the InChIKey of (4S)-6,6-dibromo-4-[dimethyl(2-methylpropyl)silyl]oxyhex-5-enoic acid?
The InChIKey is QJCJVKHGMGOPQD-JTQLQIEISA-N. The full InChI is InChI=1S/C12H22Br2O3Si/c1-9(2)8-18(3,4)17-10(7-11(13)14)5-6-12(15)16/h7,9-10H,5-6,8H2,1-4H3,(H,15,16)/t10-/m0/s1.
What are the key properties of (4S)-6,6-dibromo-4-[dimethyl(2-methylpropyl)silyl]oxyhex-5-enoic acid?
(4S)-6,6-dibromo-4-[dimethyl(2-methylpropyl)silyl]oxyhex-5-enoic acid has a molecular weight of 402.20 g/mol, XLogP of 4.73, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-6,6-dibromo-4-[dimethyl(2-methylpropyl)silyl]oxyhex-5-enoic acid is sourced from PubChem (CID 90358327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).