C20H22F4N2OS — CID 90358542
N'-[2,5-dimethyl-4-[3-(1,1,2,2-tetrafluoroethylsulfanyl)phenoxy]phenyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 90358542) has the molecular formula C20H22F4N2OS and a molecular weight of 414.47 g/mol. Its IUPAC name is N'-[2,5-dimethyl-4-[3-(1,1,2,2-tetrafluoroethylsulfanyl)phenoxy]phenyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2,5-dimethyl-4-[3-(1,1,2,2-tetrafluoroethylsulfanyl)phenoxy]phenyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 90358542 |
| Molecular Formula | C20H22F4N2OS |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | N'-[2,5-dimethyl-4-[3-(1,1,2,2-tetrafluoroethylsulfanyl)phenoxy]phenyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(Oc2cccc(SC(F)(F)C(F)F)c2)cc1C |
| InChI | InChI=1S/C20H22F4N2OS/c1-5-26(4)12-25-17-9-14(3)18(10-13(17)2)27-15-7-6-8-16(11-15)28-20(23,24)19(21)22/h6-12,19H,5H2,1-4H3/b25-12+ |
| InChIKey | WVNQSICBEDLHDK-BRJLIKDPSA-N |
| XLogP | 6.66 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|