C44H42F6N2S2 — CID 90359596
4-[5-[7-[3,5-bis(trifluoromethyl)phenyl]-9,9-dihexylfluoren-2-yl]thiophen-2-yl]-7-methyl-2,1,3-benzothiadiazole (PubChem CID 90359596) has the molecular formula C44H42F6N2S2 and a molecular weight of 776.96 g/mol. Its IUPAC name is 4-[5-[7-[3,5-bis(trifluoromethyl)phenyl]-9,9-dihexylfluoren-2-yl]thiophen-2-yl]-7-methyl-2,1,3-benzothiadiazole.
| Compound Name | 4-[5-[7-[3,5-bis(trifluoromethyl)phenyl]-9,9-dihexylfluoren-2-yl]thiophen-2-yl]-7-methyl-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 90359596 |
| Molecular Formula | C44H42F6N2S2 |
| Molecular Weight | 776.96 g/mol |
| Exact Mass | 776.27 |
| IUPAC Name | 4-[5-[7-[3,5-bis(trifluoromethyl)phenyl]-9,9-dihexylfluoren-2-yl]thiophen-2-yl]-7-methyl-2,1,3-benzothiadiazole |
| SMILES | CCCCCCC1(CCCCCC)c2cc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)ccc2-c2ccc(-c3ccc(-c4ccc(C)c5nsnc45)s3)cc21 |
| InChI | InChI=1S/C44H42F6N2S2/c1-4-6-8-10-20-42(21-11-9-7-5-2)36-24-28(30-22-31(43(45,46)47)26-32(23-30)44(48,49)50)13-16-33(36)34-17-14-29(25-37(34)42)38-18-19-39(53-38)35-15-12-27(3)40-41(35)52-54-51-40/h12-19,22-26H,4-11,20-21H2,1-3H3 |
| InChIKey | CLWBEUNSIMQUMP-UHFFFAOYSA-N |
| XLogP | 15.31 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.96 |
| LogP ≤ 5 | 15.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|