C12H13ClN4OS — CID 90359899
N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-2-methylsulfanylpropanamide (PubChem CID 90359899) has the molecular formula C12H13ClN4OS and a molecular weight of 296.78 g/mol. Its IUPAC name is N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-2-methylsulfanylpropanamide.
| Compound Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-2-methylsulfanylpropanamide |
|---|---|
| PubChem CID | 90359899 |
| Molecular Formula | C12H13ClN4OS |
| Molecular Weight | 296.78 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-2-methylsulfanylpropanamide |
| SMILES | CSC(C)C(=O)Nc1cn(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C12H13ClN4OS/c1-8(19-2)12(18)15-10-7-17(16-11(10)13)9-4-3-5-14-6-9/h3-8H,1-2H3,(H,15,18) |
| InChIKey | KNKBUISIVBRINB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.78 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |