About (3,5-diacetyloxy-4,6-dimethyloxan-2-yl)methyl acetate
(3,5-diacetyloxy-4,6-dimethyloxan-2-yl)methyl acetate (PubChem CID 90360008) has the molecular formula C14H22O7
and a molecular weight of 302.32 g/mol. Its IUPAC name is (3,5-diacetyloxy-4,6-dimethyloxan-2-yl)methyl acetate.
Molecular Properties
| Compound Name | (3,5-diacetyloxy-4,6-dimethyloxan-2-yl)methyl acetate |
| PubChem CID | 90360008 |
| Molecular Formula | C14H22O7 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | (3,5-diacetyloxy-4,6-dimethyloxan-2-yl)methyl acetate |
| SMILES | CC(=O)OCC1OC(C)C(OC(C)=O)C(C)C1OC(C)=O |
| InChI | InChI=1S/C14H22O7/c1-7-13(20-10(4)16)8(2)19-12(6-18-9(3)15)14(7)21-11(5)17/h7-8,12-14H,6H2,1-5H3 |
| InChIKey | TWHYCCFQBRTMFA-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze (3,5-diacetyloxy-4,6-dimethyloxan-2-yl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-diacetyloxy-4,6-dimethyloxan-2-yl)methyl acetate?
The IUPAC name of (3,5-diacetyloxy-4,6-dimethyloxan-2-yl)methyl acetate (CID 90360008) is (3,5-diacetyloxy-4,6-dimethyloxan-2-yl)methyl acetate.
What is the SMILES notation for (3,5-diacetyloxy-4,6-dimethyloxan-2-yl)methyl acetate?
The canonical SMILES for (3,5-diacetyloxy-4,6-dimethyloxan-2-yl)methyl acetate is CC(=O)OCC1OC(C)C(OC(C)=O)C(C)C1OC(C)=O.
What is the InChIKey of (3,5-diacetyloxy-4,6-dimethyloxan-2-yl)methyl acetate?
The InChIKey is TWHYCCFQBRTMFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O7/c1-7-13(20-10(4)16)8(2)19-12(6-18-9(3)15)14(7)21-11(5)17/h7-8,12-14H,6H2,1-5H3.
What are the key properties of (3,5-diacetyloxy-4,6-dimethyloxan-2-yl)methyl acetate?
(3,5-diacetyloxy-4,6-dimethyloxan-2-yl)methyl acetate has a molecular weight of 302.32 g/mol, XLogP of 0.84, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-diacetyloxy-4,6-dimethyloxan-2-yl)methyl acetate is sourced from PubChem (CID 90360008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).