C22H27N5O2 — CID 90360040
(3aR,4S,6aS)-2-(5-tert-butyl-1H-pyrazole-3-carbonyl)spiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,2'-1,3-dihydroquinazoline]-4'-one (PubChem CID 90360040) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is (3aR,4S,6aS)-2-(5-tert-butyl-1H-pyrazole-3-carbonyl)spiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,2'-1,3-dihydroquinazoline]-4'-one.
| Compound Name | (3aR,4S,6aS)-2-(5-tert-butyl-1H-pyrazole-3-carbonyl)spiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,2'-1,3-dihydroquinazoline]-4'-one |
|---|---|
| PubChem CID | 90360040 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | (3aR,4S,6aS)-2-(5-tert-butyl-1H-pyrazole-3-carbonyl)spiro[1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,2'-1,3-dihydroquinazoline]-4'-one |
| SMILES | CC(C)(C)c1cc(C(=O)N2C[C@H]3CC[C@]4(NC(=O)c5ccccc5N4)[C@H]3C2)n[nH]1 |
| InChI | InChI=1S/C22H27N5O2/c1-21(2,3)18-10-17(25-26-18)20(29)27-11-13-8-9-22(15(13)12-27)23-16-7-5-4-6-14(16)19(28)24-22/h4-7,10,13,15,23H,8-9,11-12H2,1-3H3,(H,24,28)(H,25,26)/t13-,15+,22+/m1/s1 |
| InChIKey | SNXIKTKBJPRQCC-OXDBHQQFSA-N |
| XLogP | 2.74 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |