C23H27N3OS — CID 9036031
N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[methyl-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]propanamide (PubChem CID 9036031) has the molecular formula C23H27N3OS and a molecular weight of 393.56 g/mol. Its IUPAC name is N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[methyl-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]propanamide.
| Compound Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[methyl-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]propanamide |
|---|---|
| PubChem CID | 9036031 |
| Molecular Formula | C23H27N3OS |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[methyl-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]propanamide |
| SMILES | CN(CCC(=O)Nc1sc2c(c1C#N)CCCC2)[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C23H27N3OS/c1-26(20-11-6-8-16-7-2-3-9-17(16)20)14-13-22(27)25-23-19(15-24)18-10-4-5-12-21(18)28-23/h2-3,7,9,20H,4-6,8,10-14H2,1H3,(H,25,27)/t20-/m1/s1 |
| InChIKey | SMUZIIKHQMKHLD-HXUWFJFHSA-N |
| XLogP | 4.84 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |